C24H36N2O3 — CID 11870655
[(1R,4S,5S,8R,9R)-4-[4-(dimethylamino)phenyl]-6,8,9-trimethyl-3-oxabicyclo[3.3.1]non-6-en-1-yl]methyl N-propan-2-ylcarbamate (PubChem CID 11870655) has the molecular formula C24H36N2O3 and a molecular weight of 400.56 g/mol. Its IUPAC name is [(1R,4S,5S,8R,9R)-4-[4-(dimethylamino)phenyl]-6,8,9-trimethyl-3-oxabicyclo[3.3.1]non-6-en-1-yl]methyl N-propan-2-ylcarbamate.
| Compound Name | [(1R,4S,5S,8R,9R)-4-[4-(dimethylamino)phenyl]-6,8,9-trimethyl-3-oxabicyclo[3.3.1]non-6-en-1-yl]methyl N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 11870655 |
| Molecular Formula | C24H36N2O3 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.27 |
| IUPAC Name | [(1R,4S,5S,8R,9R)-4-[4-(dimethylamino)phenyl]-6,8,9-trimethyl-3-oxabicyclo[3.3.1]non-6-en-1-yl]methyl N-propan-2-ylcarbamate |
| SMILES | CC1=C[C@@H](C)[C@]2(COC(=O)NC(C)C)CO[C@H](c3ccc(N(C)C)cc3)[C@H]1[C@H]2C |
| InChI | InChI=1S/C24H36N2O3/c1-15(2)25-23(27)29-14-24-13-28-22(19-8-10-20(11-9-19)26(6)7)21(18(24)5)16(3)12-17(24)4/h8-12,15,17-18,21-22H,13-14H2,1-7H3,(H,25,27)/t17-,18-,21-,22-,24-/m1/s1 |
| InChIKey | MATUOSYEEAMWHP-RUGFMQOOSA-N |
| XLogP | 4.79 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|