C22H37NO3 — CID 98656621
[(1R,4S,5R,8S,9R)-6,8,9-trimethyl-4-propyl-3-oxabicyclo[3.3.1]non-6-en-1-yl]methyl N-cyclohexylcarbamate (PubChem CID 98656621) has the molecular formula C22H37NO3 and a molecular weight of 363.54 g/mol. Its IUPAC name is [(1R,4S,5R,8S,9R)-6,8,9-trimethyl-4-propyl-3-oxabicyclo[3.3.1]non-6-en-1-yl]methyl N-cyclohexylcarbamate.
| Compound Name | [(1R,4S,5R,8S,9R)-6,8,9-trimethyl-4-propyl-3-oxabicyclo[3.3.1]non-6-en-1-yl]methyl N-cyclohexylcarbamate |
|---|---|
| PubChem CID | 98656621 |
| Molecular Formula | C22H37NO3 |
| Molecular Weight | 363.54 g/mol |
| Exact Mass | 363.28 |
| IUPAC Name | [(1R,4S,5R,8S,9R)-6,8,9-trimethyl-4-propyl-3-oxabicyclo[3.3.1]non-6-en-1-yl]methyl N-cyclohexylcarbamate |
| SMILES | CCC[C@@H]1OC[C@]2(COC(=O)NC3CCCCC3)[C@H](C)[C@@H]1C(C)=C[C@@H]2C |
| InChI | InChI=1S/C22H37NO3/c1-5-9-19-20-15(2)12-16(3)22(13-25-19,17(20)4)14-26-21(24)23-18-10-7-6-8-11-18/h12,16-20H,5-11,13-14H2,1-4H3,(H,23,24)/t16-,17+,19-,20-,22+/m0/s1 |
| InChIKey | VBWAQBZDGGCZAO-SRVURFJDSA-N |
| XLogP | 5.08 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.54 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|