C21H33NO3 — CID 3842529
(4-ethenyl-6,8,9-trimethyl-3-oxabicyclo[3.3.1]non-6-en-1-yl)methyl N-cyclohexylcarbamate (PubChem CID 3842529) has the molecular formula C21H33NO3 and a molecular weight of 347.50 g/mol. Its IUPAC name is (4-ethenyl-6,8,9-trimethyl-3-oxabicyclo[3.3.1]non-6-en-1-yl)methyl N-cyclohexylcarbamate.
| Compound Name | (4-ethenyl-6,8,9-trimethyl-3-oxabicyclo[3.3.1]non-6-en-1-yl)methyl N-cyclohexylcarbamate |
|---|---|
| PubChem CID | 3842529 |
| Molecular Formula | C21H33NO3 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.25 |
| IUPAC Name | (4-ethenyl-6,8,9-trimethyl-3-oxabicyclo[3.3.1]non-6-en-1-yl)methyl N-cyclohexylcarbamate |
| SMILES | C=CC1OCC2(COC(=O)NC3CCCCC3)C(C)C=C(C)C1C2C |
| InChI | InChI=1S/C21H33NO3/c1-5-18-19-14(2)11-15(3)21(12-24-18,16(19)4)13-25-20(23)22-17-9-7-6-8-10-17/h5,11,15-19H,1,6-10,12-13H2,2-4H3,(H,22,23) |
| InChIKey | AETPGHAWXAGDBJ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|