C27H33NO3 — CID 23734000
[(1R,9S)-4-[4-(dimethylamino)phenyl]-6,8,9-trimethyl-3-oxabicyclo[3.3.1]non-6-en-1-yl]methyl benzoate (PubChem CID 23734000) has the molecular formula C27H33NO3 and a molecular weight of 419.57 g/mol. Its IUPAC name is [(1R,9S)-4-[4-(dimethylamino)phenyl]-6,8,9-trimethyl-3-oxabicyclo[3.3.1]non-6-en-1-yl]methyl benzoate.
| Compound Name | [(1R,9S)-4-[4-(dimethylamino)phenyl]-6,8,9-trimethyl-3-oxabicyclo[3.3.1]non-6-en-1-yl]methyl benzoate |
|---|---|
| PubChem CID | 23734000 |
| Molecular Formula | C27H33NO3 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.25 |
| IUPAC Name | [(1R,9S)-4-[4-(dimethylamino)phenyl]-6,8,9-trimethyl-3-oxabicyclo[3.3.1]non-6-en-1-yl]methyl benzoate |
| SMILES | CC1=CC(C)[C@]2(COC(=O)c3ccccc3)COC(c3ccc(N(C)C)cc3)C1[C@@H]2C |
| InChI | InChI=1S/C27H33NO3/c1-18-15-19(2)27(17-31-26(29)22-9-7-6-8-10-22)16-30-25(24(18)20(27)3)21-11-13-23(14-12-21)28(4)5/h6-15,19-20,24-25H,16-17H2,1-5H3/t19?,20-,24?,25?,27+/m0/s1 |
| InChIKey | HHLRLOXDIYHWKX-DAOPRGEJSA-N |
| XLogP | 5.52 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|