C20H28ClNO2 — CID 178090378
[4-[2-chloro-4-(dimethylamino)phenyl]-6,8,9-trimethyl-3-oxabicyclo[3.3.1]non-6-en-1-yl]methanol (PubChem CID 178090378) has the molecular formula C20H28ClNO2 and a molecular weight of 349.90 g/mol. Its IUPAC name is [4-[2-chloro-4-(dimethylamino)phenyl]-6,8,9-trimethyl-3-oxabicyclo[3.3.1]non-6-en-1-yl]methanol.
| Compound Name | [4-[2-chloro-4-(dimethylamino)phenyl]-6,8,9-trimethyl-3-oxabicyclo[3.3.1]non-6-en-1-yl]methanol |
|---|---|
| PubChem CID | 178090378 |
| Molecular Formula | C20H28ClNO2 |
| Molecular Weight | 349.90 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | [4-[2-chloro-4-(dimethylamino)phenyl]-6,8,9-trimethyl-3-oxabicyclo[3.3.1]non-6-en-1-yl]methanol |
| SMILES | CC1=CC(C)C2(CO)COC(c3ccc(N(C)C)cc3Cl)C1C2C |
| InChI | InChI=1S/C20H28ClNO2/c1-12-8-13(2)20(10-23)11-24-19(18(12)14(20)3)16-7-6-15(22(4)5)9-17(16)21/h6-9,13-14,18-19,23H,10-11H2,1-5H3 |
| InChIKey | GOHNEPFZHWSWTJ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.90 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|