C20H27ClN2O — CID 18998082
3-chloro-4-[[4-(dimethylamino)phenyl]-propan-2-yloxymethyl]-N,N-dimethylaniline (PubChem CID 18998082) has the molecular formula C20H27ClN2O and a molecular weight of 346.90 g/mol. Its IUPAC name is 3-chloro-4-[[4-(dimethylamino)phenyl]-propan-2-yloxymethyl]-N,N-dimethylaniline.
| Compound Name | 3-chloro-4-[[4-(dimethylamino)phenyl]-propan-2-yloxymethyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 18998082 |
| Molecular Formula | C20H27ClN2O |
| Molecular Weight | 346.90 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 3-chloro-4-[[4-(dimethylamino)phenyl]-propan-2-yloxymethyl]-N,N-dimethylaniline |
| SMILES | CC(C)OC(c1ccc(N(C)C)cc1)c1ccc(N(C)C)cc1Cl |
| InChI | InChI=1S/C20H27ClN2O/c1-14(2)24-20(15-7-9-16(10-8-15)22(3)4)18-12-11-17(23(5)6)13-19(18)21/h7-14,20H,1-6H3 |
| InChIKey | ZHVPZDOXJWJALY-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.90 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|