C22H32N2O3 — CID 124867914
[(1R,4R,5R,8R,9R)-6,8,9-trimethyl-4-pyridin-3-yl-3-oxabicyclo[3.3.1]non-6-en-1-yl]methyl N-butylcarbamate (PubChem CID 124867914) has the molecular formula C22H32N2O3 and a molecular weight of 372.51 g/mol. Its IUPAC name is [(1R,4R,5R,8R,9R)-6,8,9-trimethyl-4-pyridin-3-yl-3-oxabicyclo[3.3.1]non-6-en-1-yl]methyl N-butylcarbamate.
| Compound Name | [(1R,4R,5R,8R,9R)-6,8,9-trimethyl-4-pyridin-3-yl-3-oxabicyclo[3.3.1]non-6-en-1-yl]methyl N-butylcarbamate |
|---|---|
| PubChem CID | 124867914 |
| Molecular Formula | C22H32N2O3 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | [(1R,4R,5R,8R,9R)-6,8,9-trimethyl-4-pyridin-3-yl-3-oxabicyclo[3.3.1]non-6-en-1-yl]methyl N-butylcarbamate |
| SMILES | CCCCNC(=O)OC[C@]12CO[C@@H](c3cccnc3)[C@@H](C(C)=C[C@H]1C)[C@H]2C |
| InChI | InChI=1S/C22H32N2O3/c1-5-6-10-24-21(25)27-14-22-13-26-20(18-8-7-9-23-12-18)19(17(22)4)15(2)11-16(22)3/h7-9,11-12,16-17,19-20H,5-6,10,13-14H2,1-4H3,(H,24,25)/t16-,17-,19+,20+,22-/m1/s1 |
| InChIKey | VUUHTGJJJVCBFX-AMVAKQTESA-N |
| XLogP | 4.51 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|