C11H16N2O2 — CID 14002804
pyridin-3-ylmethyl N-butylcarbamate (PubChem CID 14002804) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is pyridin-3-ylmethyl N-butylcarbamate.
| Compound Name | pyridin-3-ylmethyl N-butylcarbamate |
|---|---|
| PubChem CID | 14002804 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | pyridin-3-ylmethyl N-butylcarbamate |
| SMILES | CCCCNC(=O)OCc1cccnc1 |
| InChI | InChI=1S/C11H16N2O2/c1-2-3-7-13-11(14)15-9-10-5-4-6-12-8-10/h4-6,8H,2-3,7,9H2,1H3,(H,13,14) |
| InChIKey | GBTNTSPTPCRBCF-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|