C12H19N3O — CID 78786414
3-butyl-1-methyl-1-(pyridin-3-ylmethyl)urea (PubChem CID 78786414) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is 3-butyl-1-methyl-1-(pyridin-3-ylmethyl)urea.
| Compound Name | 3-butyl-1-methyl-1-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 78786414 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | 3-butyl-1-methyl-1-(pyridin-3-ylmethyl)urea |
| SMILES | CCCCNC(=O)N(C)Cc1cccnc1 |
| InChI | InChI=1S/C12H19N3O/c1-3-4-8-14-12(16)15(2)10-11-6-5-7-13-9-11/h5-7,9H,3-4,8,10H2,1-2H3,(H,14,16) |
| InChIKey | DDCNYJWQTORLFF-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|