C11H18N2OS — CID 115574006
3-butyl-1-methyl-1-(thiophen-3-ylmethyl)urea (PubChem CID 115574006) has the molecular formula C11H18N2OS and a molecular weight of 226.34 g/mol. Its IUPAC name is 3-butyl-1-methyl-1-(thiophen-3-ylmethyl)urea.
| Compound Name | 3-butyl-1-methyl-1-(thiophen-3-ylmethyl)urea |
|---|---|
| PubChem CID | 115574006 |
| Molecular Formula | C11H18N2OS |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 3-butyl-1-methyl-1-(thiophen-3-ylmethyl)urea |
| SMILES | CCCCNC(=O)N(C)Cc1ccsc1 |
| InChI | InChI=1S/C11H18N2OS/c1-3-4-6-12-11(14)13(2)8-10-5-7-15-9-10/h5,7,9H,3-4,6,8H2,1-2H3,(H,12,14) |
| InChIKey | NXPUFBMCPHHNMT-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|