C12H18N6OS — CID 31126040
3-(1-butyltetrazol-5-yl)-1-methyl-1-(thiophen-3-ylmethyl)urea (PubChem CID 31126040) has the molecular formula C12H18N6OS and a molecular weight of 294.38 g/mol. Its IUPAC name is 3-(1-butyltetrazol-5-yl)-1-methyl-1-(thiophen-3-ylmethyl)urea.
| Compound Name | 3-(1-butyltetrazol-5-yl)-1-methyl-1-(thiophen-3-ylmethyl)urea |
|---|---|
| PubChem CID | 31126040 |
| Molecular Formula | C12H18N6OS |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 3-(1-butyltetrazol-5-yl)-1-methyl-1-(thiophen-3-ylmethyl)urea |
| SMILES | CCCCn1nnnc1NC(=O)N(C)Cc1ccsc1 |
| InChI | InChI=1S/C12H18N6OS/c1-3-4-6-18-11(14-15-16-18)13-12(19)17(2)8-10-5-7-20-9-10/h5,7,9H,3-4,6,8H2,1-2H3,(H,13,14,16,19) |
| InChIKey | JLZVNYJMJXOKED-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |