C9H13N5S — CID 4726983
1-propyl-N-(thiophen-3-ylmethyl)tetrazol-5-amine (PubChem CID 4726983) has the molecular formula C9H13N5S and a molecular weight of 223.31 g/mol. Its IUPAC name is 1-propyl-N-(thiophen-3-ylmethyl)tetrazol-5-amine.
| Compound Name | 1-propyl-N-(thiophen-3-ylmethyl)tetrazol-5-amine |
|---|---|
| PubChem CID | 4726983 |
| Molecular Formula | C9H13N5S |
| Molecular Weight | 223.31 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | 1-propyl-N-(thiophen-3-ylmethyl)tetrazol-5-amine |
| SMILES | CCCn1nnnc1NCc1ccsc1 |
| InChI | InChI=1S/C9H13N5S/c1-2-4-14-9(11-12-13-14)10-6-8-3-5-15-7-8/h3,5,7H,2,4,6H2,1H3,(H,10,11,13) |
| InChIKey | KFFHIUNIEXVURD-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.31 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |