C11H16ClN3S — CID 115606235
2-propyl-N-(thiophen-3-ylmethyl)pyrazol-3-amine;hydrochloride (PubChem CID 115606235) has the molecular formula C11H16ClN3S and a molecular weight of 257.79 g/mol. Its IUPAC name is 2-propyl-N-(thiophen-3-ylmethyl)pyrazol-3-amine;hydrochloride.
| Compound Name | 2-propyl-N-(thiophen-3-ylmethyl)pyrazol-3-amine;hydrochloride |
|---|---|
| PubChem CID | 115606235 |
| Molecular Formula | C11H16ClN3S |
| Molecular Weight | 257.79 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 2-propyl-N-(thiophen-3-ylmethyl)pyrazol-3-amine;hydrochloride |
| SMILES | CCCn1nccc1NCc1ccsc1.Cl |
| InChI | InChI=1S/C11H15N3S.ClH/c1-2-6-14-11(3-5-13-14)12-8-10-4-7-15-9-10;/h3-5,7,9,12H,2,6,8H2,1H3;1H |
| InChIKey | QXZIBOYWGSJEGY-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.79 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |