C12H17ClN4 — CID 115606229
2-propyl-N-(pyridin-3-ylmethyl)pyrazol-3-amine;hydrochloride (PubChem CID 115606229) has the molecular formula C12H17ClN4 and a molecular weight of 252.75 g/mol. Its IUPAC name is 2-propyl-N-(pyridin-3-ylmethyl)pyrazol-3-amine;hydrochloride.
| Compound Name | 2-propyl-N-(pyridin-3-ylmethyl)pyrazol-3-amine;hydrochloride |
|---|---|
| PubChem CID | 115606229 |
| Molecular Formula | C12H17ClN4 |
| Molecular Weight | 252.75 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 2-propyl-N-(pyridin-3-ylmethyl)pyrazol-3-amine;hydrochloride |
| SMILES | CCCn1nccc1NCc1cccnc1.Cl |
| InChI | InChI=1S/C12H16N4.ClH/c1-2-8-16-12(5-7-15-16)14-10-11-4-3-6-13-9-11;/h3-7,9,14H,2,8,10H2,1H3;1H |
| InChIKey | DZHKAVCCIAOUOE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.75 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |