C13H16N4O — CID 55155833
1-propyl-3-(pyridin-3-ylmethylamino)pyrazin-2-one (PubChem CID 55155833) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is 1-propyl-3-(pyridin-3-ylmethylamino)pyrazin-2-one.
| Compound Name | 1-propyl-3-(pyridin-3-ylmethylamino)pyrazin-2-one |
|---|---|
| PubChem CID | 55155833 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 1-propyl-3-(pyridin-3-ylmethylamino)pyrazin-2-one |
| SMILES | CCCn1ccnc(NCc2cccnc2)c1=O |
| InChI | InChI=1S/C13H16N4O/c1-2-7-17-8-6-15-12(13(17)18)16-10-11-4-3-5-14-9-11/h3-6,8-9H,2,7,10H2,1H3,(H,15,16) |
| InChIKey | KOZLNRRLHOTIPT-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |