C14H15F2N3O — CID 63795521
3-[(2,5-difluorophenyl)methylamino]-1-propylpyrazin-2-one (PubChem CID 63795521) has the molecular formula C14H15F2N3O and a molecular weight of 279.29 g/mol. Its IUPAC name is 3-[(2,5-difluorophenyl)methylamino]-1-propylpyrazin-2-one.
| Compound Name | 3-[(2,5-difluorophenyl)methylamino]-1-propylpyrazin-2-one |
|---|---|
| PubChem CID | 63795521 |
| Molecular Formula | C14H15F2N3O |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 3-[(2,5-difluorophenyl)methylamino]-1-propylpyrazin-2-one |
| SMILES | CCCn1ccnc(NCc2cc(F)ccc2F)c1=O |
| InChI | InChI=1S/C14H15F2N3O/c1-2-6-19-7-5-17-13(14(19)20)18-9-10-8-11(15)3-4-12(10)16/h3-5,7-8H,2,6,9H2,1H3,(H,17,18) |
| InChIKey | SDEKJNRDEQHTIR-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |