C10H14N4S — CID 115606212
2-propyl-N-(1,3-thiazol-4-ylmethyl)pyrazol-3-amine (PubChem CID 115606212) has the molecular formula C10H14N4S and a molecular weight of 222.32 g/mol. Its IUPAC name is 2-propyl-N-(1,3-thiazol-4-ylmethyl)pyrazol-3-amine.
| Compound Name | 2-propyl-N-(1,3-thiazol-4-ylmethyl)pyrazol-3-amine |
|---|---|
| PubChem CID | 115606212 |
| Molecular Formula | C10H14N4S |
| Molecular Weight | 222.32 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 2-propyl-N-(1,3-thiazol-4-ylmethyl)pyrazol-3-amine |
| SMILES | CCCn1nccc1NCc1cscn1 |
| InChI | InChI=1S/C10H14N4S/c1-2-5-14-10(3-4-13-14)11-6-9-7-15-8-12-9/h3-4,7-8,11H,2,5-6H2,1H3 |
| InChIKey | POVAXINIRZSURW-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.32 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |