C9H10N4OS — CID 63831167
1-methyl-3-(1,3-thiazol-4-ylmethylamino)pyrazin-2-one (PubChem CID 63831167) has the molecular formula C9H10N4OS and a molecular weight of 222.27 g/mol. Its IUPAC name is 1-methyl-3-(1,3-thiazol-4-ylmethylamino)pyrazin-2-one.
| Compound Name | 1-methyl-3-(1,3-thiazol-4-ylmethylamino)pyrazin-2-one |
|---|---|
| PubChem CID | 63831167 |
| Molecular Formula | C9H10N4OS |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 1-methyl-3-(1,3-thiazol-4-ylmethylamino)pyrazin-2-one |
| SMILES | Cn1ccnc(NCc2cscn2)c1=O |
| InChI | InChI=1S/C9H10N4OS/c1-13-3-2-10-8(9(13)14)11-4-7-5-15-6-12-7/h2-3,5-6H,4H2,1H3,(H,10,11) |
| InChIKey | JTVXBZNTNFOKFF-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |