C10H11N3OS — CID 62939218
1-methyl-3-(thiophen-2-ylmethylamino)pyrazin-2-one (PubChem CID 62939218) has the molecular formula C10H11N3OS and a molecular weight of 221.29 g/mol. Its IUPAC name is 1-methyl-3-(thiophen-2-ylmethylamino)pyrazin-2-one.
| Compound Name | 1-methyl-3-(thiophen-2-ylmethylamino)pyrazin-2-one |
|---|---|
| PubChem CID | 62939218 |
| Molecular Formula | C10H11N3OS |
| Molecular Weight | 221.29 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | 1-methyl-3-(thiophen-2-ylmethylamino)pyrazin-2-one |
| SMILES | Cn1ccnc(NCc2cccs2)c1=O |
| InChI | InChI=1S/C10H11N3OS/c1-13-5-4-11-9(10(13)14)12-7-8-3-2-6-15-8/h2-6H,7H2,1H3,(H,11,12) |
| InChIKey | KVGLAJDAJQMZKZ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.29 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |