C9H11N5O — CID 62940431
1-methyl-3-(1H-pyrazol-5-ylmethylamino)pyrazin-2-one (PubChem CID 62940431) has the molecular formula C9H11N5O and a molecular weight of 205.22 g/mol. Its IUPAC name is 1-methyl-3-(1H-pyrazol-5-ylmethylamino)pyrazin-2-one.
| Compound Name | 1-methyl-3-(1H-pyrazol-5-ylmethylamino)pyrazin-2-one |
|---|---|
| PubChem CID | 62940431 |
| Molecular Formula | C9H11N5O |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | 1-methyl-3-(1H-pyrazol-5-ylmethylamino)pyrazin-2-one |
| SMILES | Cn1ccnc(NCc2ccn[nH]2)c1=O |
| InChI | InChI=1S/C9H11N5O/c1-14-5-4-10-8(9(14)15)11-6-7-2-3-12-13-7/h2-5H,6H2,1H3,(H,10,11)(H,12,13) |
| InChIKey | HIRMDMQCPBTADK-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |