C14H14N4S — CID 61171807
4-(pyrazol-1-ylmethyl)-N-(1,3-thiazol-4-ylmethyl)aniline (PubChem CID 61171807) has the molecular formula C14H14N4S and a molecular weight of 270.36 g/mol. Its IUPAC name is 4-(pyrazol-1-ylmethyl)-N-(1,3-thiazol-4-ylmethyl)aniline.
| Compound Name | 4-(pyrazol-1-ylmethyl)-N-(1,3-thiazol-4-ylmethyl)aniline |
|---|---|
| PubChem CID | 61171807 |
| Molecular Formula | C14H14N4S |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 4-(pyrazol-1-ylmethyl)-N-(1,3-thiazol-4-ylmethyl)aniline |
| SMILES | c1cnn(Cc2ccc(NCc3cscn3)cc2)c1 |
| InChI | InChI=1S/C14H14N4S/c1-6-17-18(7-1)9-12-2-4-13(5-3-12)15-8-14-10-19-11-16-14/h1-7,10-11,15H,8-9H2 |
| InChIKey | SVJHLTNFECGQPP-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |