C11H12N2OS — CID 60685427
4-methoxy-N-(1,3-thiazol-4-ylmethyl)aniline (PubChem CID 60685427) has the molecular formula C11H12N2OS and a molecular weight of 220.30 g/mol. Its IUPAC name is 4-methoxy-N-(1,3-thiazol-4-ylmethyl)aniline.
| Compound Name | 4-methoxy-N-(1,3-thiazol-4-ylmethyl)aniline |
|---|---|
| PubChem CID | 60685427 |
| Molecular Formula | C11H12N2OS |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 4-methoxy-N-(1,3-thiazol-4-ylmethyl)aniline |
| SMILES | COc1ccc(NCc2cscn2)cc1 |
| InChI | InChI=1S/C11H12N2OS/c1-14-11-4-2-9(3-5-11)12-6-10-7-15-8-13-10/h2-5,7-8,12H,6H2,1H3 |
| InChIKey | AVEYKCWTYKVLGS-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|