C13H15N3O2S — CID 61169060
ethyl N-[4-(1,3-thiazol-4-ylmethylamino)phenyl]carbamate (PubChem CID 61169060) has the molecular formula C13H15N3O2S and a molecular weight of 277.35 g/mol. Its IUPAC name is ethyl N-[4-(1,3-thiazol-4-ylmethylamino)phenyl]carbamate.
| Compound Name | ethyl N-[4-(1,3-thiazol-4-ylmethylamino)phenyl]carbamate |
|---|---|
| PubChem CID | 61169060 |
| Molecular Formula | C13H15N3O2S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | ethyl N-[4-(1,3-thiazol-4-ylmethylamino)phenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(NCc2cscn2)cc1 |
| InChI | InChI=1S/C13H15N3O2S/c1-2-18-13(17)16-11-5-3-10(4-6-11)14-7-12-8-19-9-15-12/h3-6,8-9,14H,2,7H2,1H3,(H,16,17) |
| InChIKey | JOKQOYLQUMHGHE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |