C12H11FN2O2S — CID 61170429
methyl 2-fluoro-5-(1,3-thiazol-4-ylmethylamino)benzoate (PubChem CID 61170429) has the molecular formula C12H11FN2O2S and a molecular weight of 266.30 g/mol. Its IUPAC name is methyl 2-fluoro-5-(1,3-thiazol-4-ylmethylamino)benzoate.
| Compound Name | methyl 2-fluoro-5-(1,3-thiazol-4-ylmethylamino)benzoate |
|---|---|
| PubChem CID | 61170429 |
| Molecular Formula | C12H11FN2O2S |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | methyl 2-fluoro-5-(1,3-thiazol-4-ylmethylamino)benzoate |
| SMILES | COC(=O)c1cc(NCc2cscn2)ccc1F |
| InChI | InChI=1S/C12H11FN2O2S/c1-17-12(16)10-4-8(2-3-11(10)13)14-5-9-6-18-7-15-9/h2-4,6-7,14H,5H2,1H3 |
| InChIKey | SVVMDSRZDZWYHR-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |