C11H11ClN2OS — CID 107268113
4-chloro-3-methoxy-N-(1,3-thiazol-4-ylmethyl)aniline (PubChem CID 107268113) has the molecular formula C11H11ClN2OS and a molecular weight of 254.74 g/mol. Its IUPAC name is 4-chloro-3-methoxy-N-(1,3-thiazol-4-ylmethyl)aniline.
| Compound Name | 4-chloro-3-methoxy-N-(1,3-thiazol-4-ylmethyl)aniline |
|---|---|
| PubChem CID | 107268113 |
| Molecular Formula | C11H11ClN2OS |
| Molecular Weight | 254.74 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 4-chloro-3-methoxy-N-(1,3-thiazol-4-ylmethyl)aniline |
| SMILES | COc1cc(NCc2cscn2)ccc1Cl |
| InChI | InChI=1S/C11H11ClN2OS/c1-15-11-4-8(2-3-10(11)12)13-5-9-6-16-7-14-9/h2-4,6-7,13H,5H2,1H3 |
| InChIKey | VTGANBRKYSXZDA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.74 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |