C15H20N2OS — CID 60687872
5-tert-butyl-2-methoxy-N-(1,3-thiazol-4-ylmethyl)aniline (PubChem CID 60687872) has the molecular formula C15H20N2OS and a molecular weight of 276.40 g/mol. Its IUPAC name is 5-tert-butyl-2-methoxy-N-(1,3-thiazol-4-ylmethyl)aniline.
| Compound Name | 5-tert-butyl-2-methoxy-N-(1,3-thiazol-4-ylmethyl)aniline |
|---|---|
| PubChem CID | 60687872 |
| Molecular Formula | C15H20N2OS |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 5-tert-butyl-2-methoxy-N-(1,3-thiazol-4-ylmethyl)aniline |
| SMILES | COc1ccc(C(C)(C)C)cc1NCc1cscn1 |
| InChI | InChI=1S/C15H20N2OS/c1-15(2,3)11-5-6-14(18-4)13(7-11)16-8-12-9-19-10-17-12/h5-7,9-10,16H,8H2,1-4H3 |
| InChIKey | SCTLXRCJDHTQEW-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |