C12H14N2S — CID 60683495
2,4-dimethyl-N-(1,3-thiazol-4-ylmethyl)aniline (PubChem CID 60683495) has the molecular formula C12H14N2S and a molecular weight of 218.32 g/mol. Its IUPAC name is 2,4-dimethyl-N-(1,3-thiazol-4-ylmethyl)aniline.
| Compound Name | 2,4-dimethyl-N-(1,3-thiazol-4-ylmethyl)aniline |
|---|---|
| PubChem CID | 60683495 |
| Molecular Formula | C12H14N2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 2,4-dimethyl-N-(1,3-thiazol-4-ylmethyl)aniline |
| SMILES | Cc1ccc(NCc2cscn2)c(C)c1 |
| InChI | InChI=1S/C12H14N2S/c1-9-3-4-12(10(2)5-9)13-6-11-7-15-8-14-11/h3-5,7-8,13H,6H2,1-2H3 |
| InChIKey | LUTWZUBWITYQJD-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |