C10H10BrN3S — CID 63830938
2-bromo-1-N-(1,3-thiazol-4-ylmethyl)benzene-1,4-diamine (PubChem CID 63830938) has the molecular formula C10H10BrN3S and a molecular weight of 284.18 g/mol. Its IUPAC name is 2-bromo-1-N-(1,3-thiazol-4-ylmethyl)benzene-1,4-diamine.
| Compound Name | 2-bromo-1-N-(1,3-thiazol-4-ylmethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 63830938 |
| Molecular Formula | C10H10BrN3S |
| Molecular Weight | 284.18 g/mol |
| Exact Mass | 282.98 |
| IUPAC Name | 2-bromo-1-N-(1,3-thiazol-4-ylmethyl)benzene-1,4-diamine |
| SMILES | Nc1ccc(NCc2cscn2)c(Br)c1 |
| InChI | InChI=1S/C10H10BrN3S/c11-9-3-7(12)1-2-10(9)13-4-8-5-15-6-14-8/h1-3,5-6,13H,4,12H2 |
| InChIKey | RTOUFORVOKIERN-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.18 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|