C11H10Br2N2OS — CID 103412233
2,4-dibromo-5-methoxy-N-(1,3-thiazol-4-ylmethyl)aniline (PubChem CID 103412233) has the molecular formula C11H10Br2N2OS and a molecular weight of 378.09 g/mol. Its IUPAC name is 2,4-dibromo-5-methoxy-N-(1,3-thiazol-4-ylmethyl)aniline.
| Compound Name | 2,4-dibromo-5-methoxy-N-(1,3-thiazol-4-ylmethyl)aniline |
|---|---|
| PubChem CID | 103412233 |
| Molecular Formula | C11H10Br2N2OS |
| Molecular Weight | 378.09 g/mol |
| Exact Mass | 375.89 |
| IUPAC Name | 2,4-dibromo-5-methoxy-N-(1,3-thiazol-4-ylmethyl)aniline |
| SMILES | COc1cc(NCc2cscn2)c(Br)cc1Br |
| InChI | InChI=1S/C11H10Br2N2OS/c1-16-11-3-10(8(12)2-9(11)13)14-4-7-5-17-6-15-7/h2-3,5-6,14H,4H2,1H3 |
| InChIKey | GNANLELQZXPPQH-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.09 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |