C12H12BrClN2OS — CID 61169650
3-bromo-5-chloro-2-ethoxy-N-(1,3-thiazol-4-ylmethyl)aniline (PubChem CID 61169650) has the molecular formula C12H12BrClN2OS and a molecular weight of 347.67 g/mol. Its IUPAC name is 3-bromo-5-chloro-2-ethoxy-N-(1,3-thiazol-4-ylmethyl)aniline.
| Compound Name | 3-bromo-5-chloro-2-ethoxy-N-(1,3-thiazol-4-ylmethyl)aniline |
|---|---|
| PubChem CID | 61169650 |
| Molecular Formula | C12H12BrClN2OS |
| Molecular Weight | 347.67 g/mol |
| Exact Mass | 345.95 |
| IUPAC Name | 3-bromo-5-chloro-2-ethoxy-N-(1,3-thiazol-4-ylmethyl)aniline |
| SMILES | CCOc1c(Br)cc(Cl)cc1NCc1cscn1 |
| InChI | InChI=1S/C12H12BrClN2OS/c1-2-17-12-10(13)3-8(14)4-11(12)15-5-9-6-18-7-16-9/h3-4,6-7,15H,2,5H2,1H3 |
| InChIKey | IVKGPAAPQLSGDW-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.67 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |