C15H13BrClF2NO — CID 106528343
3-bromo-5-chloro-N-[(3,5-difluorophenyl)methyl]-2-ethoxyaniline (PubChem CID 106528343) has the molecular formula C15H13BrClF2NO and a molecular weight of 376.63 g/mol. Its IUPAC name is 3-bromo-5-chloro-N-[(3,5-difluorophenyl)methyl]-2-ethoxyaniline.
| Compound Name | 3-bromo-5-chloro-N-[(3,5-difluorophenyl)methyl]-2-ethoxyaniline |
|---|---|
| PubChem CID | 106528343 |
| Molecular Formula | C15H13BrClF2NO |
| Molecular Weight | 376.63 g/mol |
| Exact Mass | 374.98 |
| IUPAC Name | 3-bromo-5-chloro-N-[(3,5-difluorophenyl)methyl]-2-ethoxyaniline |
| SMILES | CCOc1c(Br)cc(Cl)cc1NCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C15H13BrClF2NO/c1-2-21-15-13(16)5-10(17)6-14(15)20-8-9-3-11(18)7-12(19)4-9/h3-7,20H,2,8H2,1H3 |
| InChIKey | LQKVXQOJMGGLHC-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.63 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |