C11H11BrN2OS — CID 115877205
2-bromo-4-methoxy-N-(1,3-thiazol-4-ylmethyl)aniline (PubChem CID 115877205) has the molecular formula C11H11BrN2OS and a molecular weight of 299.19 g/mol. Its IUPAC name is 2-bromo-4-methoxy-N-(1,3-thiazol-4-ylmethyl)aniline.
| Compound Name | 2-bromo-4-methoxy-N-(1,3-thiazol-4-ylmethyl)aniline |
|---|---|
| PubChem CID | 115877205 |
| Molecular Formula | C11H11BrN2OS |
| Molecular Weight | 299.19 g/mol |
| Exact Mass | 297.98 |
| IUPAC Name | 2-bromo-4-methoxy-N-(1,3-thiazol-4-ylmethyl)aniline |
| SMILES | COc1ccc(NCc2cscn2)c(Br)c1 |
| InChI | InChI=1S/C11H11BrN2OS/c1-15-9-2-3-11(10(12)4-9)13-5-8-6-16-7-14-8/h2-4,6-7,13H,5H2,1H3 |
| InChIKey | HHXARNLLEMETQD-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.19 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|