C12H13FN2O2S — CID 84595025
2-fluoro-4,5-dimethoxy-N-(1,3-thiazol-4-ylmethyl)aniline (PubChem CID 84595025) has the molecular formula C12H13FN2O2S and a molecular weight of 268.31 g/mol. Its IUPAC name is 2-fluoro-4,5-dimethoxy-N-(1,3-thiazol-4-ylmethyl)aniline.
| Compound Name | 2-fluoro-4,5-dimethoxy-N-(1,3-thiazol-4-ylmethyl)aniline |
|---|---|
| PubChem CID | 84595025 |
| Molecular Formula | C12H13FN2O2S |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 2-fluoro-4,5-dimethoxy-N-(1,3-thiazol-4-ylmethyl)aniline |
| SMILES | COc1cc(F)c(NCc2cscn2)cc1OC |
| InChI | InChI=1S/C12H13FN2O2S/c1-16-11-3-9(13)10(4-12(11)17-2)14-5-8-6-18-7-15-8/h3-4,6-7,14H,5H2,1-2H3 |
| InChIKey | NPHBQDKUKYFWLW-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|