C11H11BrN2OS — CID 61223553
5-bromo-2-methoxy-N-(1,3-thiazol-4-ylmethyl)aniline (PubChem CID 61223553) has the molecular formula C11H11BrN2OS and a molecular weight of 299.19 g/mol. Its IUPAC name is 5-bromo-2-methoxy-N-(1,3-thiazol-4-ylmethyl)aniline.
| Compound Name | 5-bromo-2-methoxy-N-(1,3-thiazol-4-ylmethyl)aniline |
|---|---|
| PubChem CID | 61223553 |
| Molecular Formula | C11H11BrN2OS |
| Molecular Weight | 299.19 g/mol |
| Exact Mass | 297.98 |
| IUPAC Name | 5-bromo-2-methoxy-N-(1,3-thiazol-4-ylmethyl)aniline |
| SMILES | COc1ccc(Br)cc1NCc1cscn1 |
| InChI | InChI=1S/C11H11BrN2OS/c1-15-11-3-2-8(12)4-10(11)13-5-9-6-16-7-14-9/h2-4,6-7,13H,5H2,1H3 |
| InChIKey | PROHVKJMGJQAMS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.19 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |