C11H11FN2S — CID 60688792
2-fluoro-5-methyl-N-(1,3-thiazol-4-ylmethyl)aniline (PubChem CID 60688792) has the molecular formula C11H11FN2S and a molecular weight of 222.29 g/mol. Its IUPAC name is 2-fluoro-5-methyl-N-(1,3-thiazol-4-ylmethyl)aniline.
| Compound Name | 2-fluoro-5-methyl-N-(1,3-thiazol-4-ylmethyl)aniline |
|---|---|
| PubChem CID | 60688792 |
| Molecular Formula | C11H11FN2S |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 2-fluoro-5-methyl-N-(1,3-thiazol-4-ylmethyl)aniline |
| SMILES | Cc1ccc(F)c(NCc2cscn2)c1 |
| InChI | InChI=1S/C11H11FN2S/c1-8-2-3-10(12)11(4-8)13-5-9-6-15-7-14-9/h2-4,6-7,13H,5H2,1H3 |
| InChIKey | VMVKCDROAAYRTJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |