About 2-fluoro-1-N-(1,3-thiazol-4-ylmethyl)benzene-1,4-diamine
2-fluoro-1-N-(1,3-thiazol-4-ylmethyl)benzene-1,4-diamine (PubChem CID 63830940) has the molecular formula C10H10FN3S
and a molecular weight of 223.28 g/mol. Its IUPAC name is 2-fluoro-1-N-(1,3-thiazol-4-ylmethyl)benzene-1,4-diamine.
Molecular Properties
| Compound Name | 2-fluoro-1-N-(1,3-thiazol-4-ylmethyl)benzene-1,4-diamine |
| PubChem CID | 63830940 |
| Molecular Formula | C10H10FN3S |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 2-fluoro-1-N-(1,3-thiazol-4-ylmethyl)benzene-1,4-diamine |
| SMILES | Nc1ccc(NCc2cscn2)c(F)c1 |
| InChI | InChI=1S/C10H10FN3S/c11-9-3-7(12)1-2-10(9)13-4-8-5-15-6-14-8/h1-3,5-6,13H,4,12H2 |
| InChIKey | GLLNUWHBAQIIJN-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-1-N-(1,3-thiazol-4-ylmethyl)benzene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-1-N-(1,3-thiazol-4-ylmethyl)benzene-1,4-diamine?
The IUPAC name of 2-fluoro-1-N-(1,3-thiazol-4-ylmethyl)benzene-1,4-diamine (CID 63830940) is 2-fluoro-1-N-(1,3-thiazol-4-ylmethyl)benzene-1,4-diamine.
What is the SMILES notation for 2-fluoro-1-N-(1,3-thiazol-4-ylmethyl)benzene-1,4-diamine?
The canonical SMILES for 2-fluoro-1-N-(1,3-thiazol-4-ylmethyl)benzene-1,4-diamine is Nc1ccc(NCc2cscn2)c(F)c1.
What is the InChIKey of 2-fluoro-1-N-(1,3-thiazol-4-ylmethyl)benzene-1,4-diamine?
The InChIKey is GLLNUWHBAQIIJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10FN3S/c11-9-3-7(12)1-2-10(9)13-4-8-5-15-6-14-8/h1-3,5-6,13H,4,12H2.
What are the key properties of 2-fluoro-1-N-(1,3-thiazol-4-ylmethyl)benzene-1,4-diamine?
2-fluoro-1-N-(1,3-thiazol-4-ylmethyl)benzene-1,4-diamine has a molecular weight of 223.28 g/mol, XLogP of 2.48, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-1-N-(1,3-thiazol-4-ylmethyl)benzene-1,4-diamine is sourced from PubChem (CID 63830940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).