C10H9FN2S2 — CID 43303709
3-fluoro-4-(1,3-thiazol-4-ylmethylsulfanyl)aniline (PubChem CID 43303709) has the molecular formula C10H9FN2S2 and a molecular weight of 240.33 g/mol. Its IUPAC name is 3-fluoro-4-(1,3-thiazol-4-ylmethylsulfanyl)aniline.
| Compound Name | 3-fluoro-4-(1,3-thiazol-4-ylmethylsulfanyl)aniline |
|---|---|
| PubChem CID | 43303709 |
| Molecular Formula | C10H9FN2S2 |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.02 |
| IUPAC Name | 3-fluoro-4-(1,3-thiazol-4-ylmethylsulfanyl)aniline |
| SMILES | Nc1ccc(SCc2cscn2)c(F)c1 |
| InChI | InChI=1S/C10H9FN2S2/c11-9-3-7(12)1-2-10(9)15-5-8-4-14-6-13-8/h1-4,6H,5,12H2 |
| InChIKey | APHOMJBHQFIPAK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|