C13H11FN4S — CID 43303479
3-fluoro-4-(imidazo[1,2-a]pyrimidin-2-ylmethylsulfanyl)aniline (PubChem CID 43303479) has the molecular formula C13H11FN4S and a molecular weight of 274.32 g/mol. Its IUPAC name is 3-fluoro-4-(imidazo[1,2-a]pyrimidin-2-ylmethylsulfanyl)aniline.
| Compound Name | 3-fluoro-4-(imidazo[1,2-a]pyrimidin-2-ylmethylsulfanyl)aniline |
|---|---|
| PubChem CID | 43303479 |
| Molecular Formula | C13H11FN4S |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 3-fluoro-4-(imidazo[1,2-a]pyrimidin-2-ylmethylsulfanyl)aniline |
| SMILES | Nc1ccc(SCc2cn3cccnc3n2)c(F)c1 |
| InChI | InChI=1S/C13H11FN4S/c14-11-6-9(15)2-3-12(11)19-8-10-7-18-5-1-4-16-13(18)17-10/h1-7H,8,15H2 |
| InChIKey | DUEYHOAHNUWWMZ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|