About 3-(imidazo[1,2-a]pyrimidin-2-ylmethylsulfanyl)butan-1-amine
3-(imidazo[1,2-a]pyrimidin-2-ylmethylsulfanyl)butan-1-amine (PubChem CID 66228154) has the molecular formula C11H16N4S
and a molecular weight of 236.34 g/mol. Its IUPAC name is 3-(imidazo[1,2-a]pyrimidin-2-ylmethylsulfanyl)butan-1-amine.
Molecular Properties
| Compound Name | 3-(imidazo[1,2-a]pyrimidin-2-ylmethylsulfanyl)butan-1-amine |
| PubChem CID | 66228154 |
| Molecular Formula | C11H16N4S |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 3-(imidazo[1,2-a]pyrimidin-2-ylmethylsulfanyl)butan-1-amine |
| SMILES | CC(CCN)SCc1cn2cccnc2n1 |
| InChI | InChI=1S/C11H16N4S/c1-9(3-4-12)16-8-10-7-15-6-2-5-13-11(15)14-10/h2,5-7,9H,3-4,8,12H2,1H3 |
| InChIKey | VKBPQQJNKNDTJY-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(imidazo[1,2-a]pyrimidin-2-ylmethylsulfanyl)butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(imidazo[1,2-a]pyrimidin-2-ylmethylsulfanyl)butan-1-amine?
The IUPAC name of 3-(imidazo[1,2-a]pyrimidin-2-ylmethylsulfanyl)butan-1-amine (CID 66228154) is 3-(imidazo[1,2-a]pyrimidin-2-ylmethylsulfanyl)butan-1-amine.
What is the SMILES notation for 3-(imidazo[1,2-a]pyrimidin-2-ylmethylsulfanyl)butan-1-amine?
The canonical SMILES for 3-(imidazo[1,2-a]pyrimidin-2-ylmethylsulfanyl)butan-1-amine is CC(CCN)SCc1cn2cccnc2n1.
What is the InChIKey of 3-(imidazo[1,2-a]pyrimidin-2-ylmethylsulfanyl)butan-1-amine?
The InChIKey is VKBPQQJNKNDTJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4S/c1-9(3-4-12)16-8-10-7-15-6-2-5-13-11(15)14-10/h2,5-7,9H,3-4,8,12H2,1H3.
What are the key properties of 3-(imidazo[1,2-a]pyrimidin-2-ylmethylsulfanyl)butan-1-amine?
3-(imidazo[1,2-a]pyrimidin-2-ylmethylsulfanyl)butan-1-amine has a molecular weight of 236.34 g/mol, XLogP of 1.70, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(imidazo[1,2-a]pyrimidin-2-ylmethylsulfanyl)butan-1-amine is sourced from PubChem (CID 66228154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).