About 4-(imidazo[1,2-a]pyrimidin-2-ylmethylsulfanyl)quinazoline
4-(imidazo[1,2-a]pyrimidin-2-ylmethylsulfanyl)quinazoline (PubChem CID 2997679) has the molecular formula C15H11N5S
and a molecular weight of 293.36 g/mol. Its IUPAC name is 4-(imidazo[1,2-a]pyrimidin-2-ylmethylsulfanyl)quinazoline.
Molecular Properties
| Compound Name | 4-(imidazo[1,2-a]pyrimidin-2-ylmethylsulfanyl)quinazoline |
| PubChem CID | 2997679 |
| Molecular Formula | C15H11N5S |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 4-(imidazo[1,2-a]pyrimidin-2-ylmethylsulfanyl)quinazoline |
| SMILES | c1ccc2c(SCc3cn4cccnc4n3)ncnc2c1 |
| InChI | InChI=1S/C15H11N5S/c1-2-5-13-12(4-1)14(18-10-17-13)21-9-11-8-20-7-3-6-16-15(20)19-11/h1-8,10H,9H2 |
| InChIKey | GEBZKWOJZFSOJI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(imidazo[1,2-a]pyrimidin-2-ylmethylsulfanyl)quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(imidazo[1,2-a]pyrimidin-2-ylmethylsulfanyl)quinazoline?
The IUPAC name of 4-(imidazo[1,2-a]pyrimidin-2-ylmethylsulfanyl)quinazoline (CID 2997679) is 4-(imidazo[1,2-a]pyrimidin-2-ylmethylsulfanyl)quinazoline.
What is the SMILES notation for 4-(imidazo[1,2-a]pyrimidin-2-ylmethylsulfanyl)quinazoline?
The canonical SMILES for 4-(imidazo[1,2-a]pyrimidin-2-ylmethylsulfanyl)quinazoline is c1ccc2c(SCc3cn4cccnc4n3)ncnc2c1.
What is the InChIKey of 4-(imidazo[1,2-a]pyrimidin-2-ylmethylsulfanyl)quinazoline?
The InChIKey is GEBZKWOJZFSOJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N5S/c1-2-5-13-12(4-1)14(18-10-17-13)21-9-11-8-20-7-3-6-16-15(20)19-11/h1-8,10H,9H2.
What are the key properties of 4-(imidazo[1,2-a]pyrimidin-2-ylmethylsulfanyl)quinazoline?
4-(imidazo[1,2-a]pyrimidin-2-ylmethylsulfanyl)quinazoline has a molecular weight of 293.36 g/mol, XLogP of 2.96, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(imidazo[1,2-a]pyrimidin-2-ylmethylsulfanyl)quinazoline is sourced from PubChem (CID 2997679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).