C10H11FN4OS — CID 114218156
4-[[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]methylsulfanyl]-3-fluoroaniline (PubChem CID 114218156) has the molecular formula C10H11FN4OS and a molecular weight of 254.29 g/mol. Its IUPAC name is 4-[[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]methylsulfanyl]-3-fluoroaniline.
| Compound Name | 4-[[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]methylsulfanyl]-3-fluoroaniline |
|---|---|
| PubChem CID | 114218156 |
| Molecular Formula | C10H11FN4OS |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 4-[[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]methylsulfanyl]-3-fluoroaniline |
| SMILES | NCc1nc(CSc2ccc(N)cc2F)no1 |
| InChI | InChI=1S/C10H11FN4OS/c11-7-3-6(13)1-2-8(7)17-5-9-14-10(4-12)16-15-9/h1-3H,4-5,12-13H2 |
| InChIKey | KUVGMGDIOJZJNJ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 90.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|