C9H8FN3OS — CID 43303777
3-fluoro-4-(1,2,4-oxadiazol-3-ylmethylsulfanyl)aniline (PubChem CID 43303777) has the molecular formula C9H8FN3OS and a molecular weight of 225.25 g/mol. Its IUPAC name is 3-fluoro-4-(1,2,4-oxadiazol-3-ylmethylsulfanyl)aniline.
| Compound Name | 3-fluoro-4-(1,2,4-oxadiazol-3-ylmethylsulfanyl)aniline |
|---|---|
| PubChem CID | 43303777 |
| Molecular Formula | C9H8FN3OS |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | 3-fluoro-4-(1,2,4-oxadiazol-3-ylmethylsulfanyl)aniline |
| SMILES | Nc1ccc(SCc2ncon2)c(F)c1 |
| InChI | InChI=1S/C9H8FN3OS/c10-7-3-6(11)1-2-8(7)15-4-9-12-5-14-13-9/h1-3,5H,4,11H2 |
| InChIKey | KHIZGTDQBUQQPD-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|