C13H10Cl2FNS — CID 43303504
4-[(3,4-dichlorophenyl)methylsulfanyl]-3-fluoroaniline (PubChem CID 43303504) has the molecular formula C13H10Cl2FNS and a molecular weight of 302.20 g/mol. Its IUPAC name is 4-[(3,4-dichlorophenyl)methylsulfanyl]-3-fluoroaniline.
| Compound Name | 4-[(3,4-dichlorophenyl)methylsulfanyl]-3-fluoroaniline |
|---|---|
| PubChem CID | 43303504 |
| Molecular Formula | C13H10Cl2FNS |
| Molecular Weight | 302.20 g/mol |
| Exact Mass | 300.99 |
| IUPAC Name | 4-[(3,4-dichlorophenyl)methylsulfanyl]-3-fluoroaniline |
| SMILES | Nc1ccc(SCc2ccc(Cl)c(Cl)c2)c(F)c1 |
| InChI | InChI=1S/C13H10Cl2FNS/c14-10-3-1-8(5-11(10)15)7-18-13-4-2-9(17)6-12(13)16/h1-6H,7,17H2 |
| InChIKey | FSCMCYRDKHKFMM-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.20 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|