C13H9Cl2F2NS — CID 63462164
4-[(3,4-dichlorophenyl)methylsulfanyl]-3,5-difluoroaniline (PubChem CID 63462164) has the molecular formula C13H9Cl2F2NS and a molecular weight of 320.19 g/mol. Its IUPAC name is 4-[(3,4-dichlorophenyl)methylsulfanyl]-3,5-difluoroaniline.
| Compound Name | 4-[(3,4-dichlorophenyl)methylsulfanyl]-3,5-difluoroaniline |
|---|---|
| PubChem CID | 63462164 |
| Molecular Formula | C13H9Cl2F2NS |
| Molecular Weight | 320.19 g/mol |
| Exact Mass | 318.98 |
| IUPAC Name | 4-[(3,4-dichlorophenyl)methylsulfanyl]-3,5-difluoroaniline |
| SMILES | Nc1cc(F)c(SCc2ccc(Cl)c(Cl)c2)c(F)c1 |
| InChI | InChI=1S/C13H9Cl2F2NS/c14-9-2-1-7(3-10(9)15)6-19-13-11(16)4-8(18)5-12(13)17/h1-5H,6,18H2 |
| InChIKey | UJWNTGGOXGFMJQ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.19 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|