C11H11F2N3S — CID 82878022
3,5-difluoro-4-[(1-methylpyrazol-3-yl)methylsulfanyl]aniline (PubChem CID 82878022) has the molecular formula C11H11F2N3S and a molecular weight of 255.29 g/mol. Its IUPAC name is 3,5-difluoro-4-[(1-methylpyrazol-3-yl)methylsulfanyl]aniline.
| Compound Name | 3,5-difluoro-4-[(1-methylpyrazol-3-yl)methylsulfanyl]aniline |
|---|---|
| PubChem CID | 82878022 |
| Molecular Formula | C11H11F2N3S |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | 3,5-difluoro-4-[(1-methylpyrazol-3-yl)methylsulfanyl]aniline |
| SMILES | Cn1ccc(CSc2c(F)cc(N)cc2F)n1 |
| InChI | InChI=1S/C11H11F2N3S/c1-16-3-2-8(15-16)6-17-11-9(12)4-7(14)5-10(11)13/h2-5H,6,14H2,1H3 |
| InChIKey | KIJLNJLQGKGJRH-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|