C13H15F2N3S — CID 64772644
3,5-difluoro-4-[(1-propan-2-ylpyrazol-3-yl)methylsulfanyl]aniline (PubChem CID 64772644) has the molecular formula C13H15F2N3S and a molecular weight of 283.35 g/mol. Its IUPAC name is 3,5-difluoro-4-[(1-propan-2-ylpyrazol-3-yl)methylsulfanyl]aniline.
| Compound Name | 3,5-difluoro-4-[(1-propan-2-ylpyrazol-3-yl)methylsulfanyl]aniline |
|---|---|
| PubChem CID | 64772644 |
| Molecular Formula | C13H15F2N3S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 3,5-difluoro-4-[(1-propan-2-ylpyrazol-3-yl)methylsulfanyl]aniline |
| SMILES | CC(C)n1ccc(CSc2c(F)cc(N)cc2F)n1 |
| InChI | InChI=1S/C13H15F2N3S/c1-8(2)18-4-3-10(17-18)7-19-13-11(14)5-9(16)6-12(13)15/h3-6,8H,7,16H2,1-2H3 |
| InChIKey | RGZLOELUYOOCKJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|