C15H18Cl2FN3 — CID 64772421
2-(2,4-dichloro-5-fluorophenyl)-1-(1-propan-2-ylpyrazol-3-yl)propan-2-amine (PubChem CID 64772421) has the molecular formula C15H18Cl2FN3 and a molecular weight of 330.23 g/mol. Its IUPAC name is 2-(2,4-dichloro-5-fluorophenyl)-1-(1-propan-2-ylpyrazol-3-yl)propan-2-amine.
| Compound Name | 2-(2,4-dichloro-5-fluorophenyl)-1-(1-propan-2-ylpyrazol-3-yl)propan-2-amine |
|---|---|
| PubChem CID | 64772421 |
| Molecular Formula | C15H18Cl2FN3 |
| Molecular Weight | 330.23 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 2-(2,4-dichloro-5-fluorophenyl)-1-(1-propan-2-ylpyrazol-3-yl)propan-2-amine |
| SMILES | CC(C)n1ccc(CC(C)(N)c2cc(F)c(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C15H18Cl2FN3/c1-9(2)21-5-4-10(20-21)8-15(3,19)11-6-14(18)13(17)7-12(11)16/h4-7,9H,8,19H2,1-3H3 |
| InChIKey | FKTWJODQTPCPBM-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.23 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|