C9H8Cl2F3N — CID 131580102
2-(2,4-dichloro-5-fluorophenyl)-1,1-difluoropropan-2-amine (PubChem CID 131580102) has the molecular formula C9H8Cl2F3N and a molecular weight of 258.07 g/mol. Its IUPAC name is 2-(2,4-dichloro-5-fluorophenyl)-1,1-difluoropropan-2-amine.
| Compound Name | 2-(2,4-dichloro-5-fluorophenyl)-1,1-difluoropropan-2-amine |
|---|---|
| PubChem CID | 131580102 |
| Molecular Formula | C9H8Cl2F3N |
| Molecular Weight | 258.07 g/mol |
| Exact Mass | 257.00 |
| IUPAC Name | 2-(2,4-dichloro-5-fluorophenyl)-1,1-difluoropropan-2-amine |
| SMILES | CC(N)(c1cc(F)c(Cl)cc1Cl)C(F)F |
| InChI | InChI=1S/C9H8Cl2F3N/c1-9(15,8(13)14)4-2-7(12)6(11)3-5(4)10/h2-3,8H,15H2,1H3 |
| InChIKey | FUGYKBIDYUAMGN-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.07 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|