About 1,5-dichloro-2-(1,1-dichloroethyl)-4-fluorobenzene
1,5-dichloro-2-(1,1-dichloroethyl)-4-fluorobenzene (PubChem CID 175360558) has the molecular formula C8H5Cl4F
and a molecular weight of 261.94 g/mol. Its IUPAC name is 1,5-dichloro-2-(1,1-dichloroethyl)-4-fluorobenzene.
Molecular Properties
| Compound Name | 1,5-dichloro-2-(1,1-dichloroethyl)-4-fluorobenzene |
| PubChem CID | 175360558 |
| Molecular Formula | C8H5Cl4F |
| Molecular Weight | 261.94 g/mol |
| Exact Mass | 259.91 |
| IUPAC Name | 1,5-dichloro-2-(1,1-dichloroethyl)-4-fluorobenzene |
| SMILES | CC(Cl)(Cl)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C8H5Cl4F/c1-8(11,12)4-2-7(13)6(10)3-5(4)9/h2-3H,1H3 |
| InChIKey | FMDAZNFKGANFBI-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.94 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 1,5-dichloro-2-(1,1-dichloroethyl)-4-fluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dichloro-2-(1,1-dichloroethyl)-4-fluorobenzene?
The IUPAC name of 1,5-dichloro-2-(1,1-dichloroethyl)-4-fluorobenzene (CID 175360558) is 1,5-dichloro-2-(1,1-dichloroethyl)-4-fluorobenzene.
What is the SMILES notation for 1,5-dichloro-2-(1,1-dichloroethyl)-4-fluorobenzene?
The canonical SMILES for 1,5-dichloro-2-(1,1-dichloroethyl)-4-fluorobenzene is CC(Cl)(Cl)c1cc(F)c(Cl)cc1Cl.
What is the InChIKey of 1,5-dichloro-2-(1,1-dichloroethyl)-4-fluorobenzene?
The InChIKey is FMDAZNFKGANFBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5Cl4F/c1-8(11,12)4-2-7(13)6(10)3-5(4)9/h2-3H,1H3.
What are the key properties of 1,5-dichloro-2-(1,1-dichloroethyl)-4-fluorobenzene?
1,5-dichloro-2-(1,1-dichloroethyl)-4-fluorobenzene has a molecular weight of 261.94 g/mol, XLogP of 4.78, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dichloro-2-(1,1-dichloroethyl)-4-fluorobenzene is sourced from PubChem (CID 175360558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).