C8H5Cl4F — CID 175360558
1,5-dichloro-2-(1,1-dichloroethyl)-4-fluorobenzene (PubChem CID 175360558) has the molecular formula C8H5Cl4F and a molecular weight of 261.94 g/mol. Its IUPAC name is 1,5-dichloro-2-(1,1-dichloroethyl)-4-fluorobenzene.
| Compound Name | 1,5-dichloro-2-(1,1-dichloroethyl)-4-fluorobenzene |
|---|---|
| PubChem CID | 175360558 |
| Molecular Formula | C8H5Cl4F |
| Molecular Weight | 261.94 g/mol |
| Exact Mass | 259.91 |
| IUPAC Name | 1,5-dichloro-2-(1,1-dichloroethyl)-4-fluorobenzene |
| SMILES | CC(Cl)(Cl)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C8H5Cl4F/c1-8(11,12)4-2-7(13)6(10)3-5(4)9/h2-3H,1H3 |
| InChIKey | FMDAZNFKGANFBI-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.94 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|