C7H2Cl5F — CID 156548422
1,4-dichloro-2-fluoro-5-(trichloromethyl)benzene (PubChem CID 156548422) has the molecular formula C7H2Cl5F and a molecular weight of 282.36 g/mol. Its IUPAC name is 1,4-dichloro-2-fluoro-5-(trichloromethyl)benzene.
| Compound Name | 1,4-dichloro-2-fluoro-5-(trichloromethyl)benzene |
|---|---|
| PubChem CID | 156548422 |
| Molecular Formula | C7H2Cl5F |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 279.86 |
| IUPAC Name | 1,4-dichloro-2-fluoro-5-(trichloromethyl)benzene |
| SMILES | Fc1cc(Cl)c(C(Cl)(Cl)Cl)cc1Cl |
| InChI | InChI=1S/C7H2Cl5F/c8-4-2-6(13)5(9)1-3(4)7(10,11)12/h1-2H |
| InChIKey | SZQMKUNMMIXVRH-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|